C10H17N5O2 — CID 54863171
2-amino-N-[1-[2-(methylamino)-2-oxoethyl]pyrazol-4-yl]butanamide (PubChem CID 54863171) has the molecular formula C10H17N5O2 and a molecular weight of 239.28 g/mol. Its IUPAC name is 2-amino-N-[1-[2-(methylamino)-2-oxoethyl]pyrazol-4-yl]butanamide.
| Compound Name | 2-amino-N-[1-[2-(methylamino)-2-oxoethyl]pyrazol-4-yl]butanamide |
|---|---|
| PubChem CID | 54863171 |
| Molecular Formula | C10H17N5O2 |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | 2-amino-N-[1-[2-(methylamino)-2-oxoethyl]pyrazol-4-yl]butanamide |
| SMILES | CCC(N)C(=O)Nc1cnn(CC(=O)NC)c1 |
| InChI | InChI=1S/C10H17N5O2/c1-3-8(11)10(17)14-7-4-13-15(5-7)6-9(16)12-2/h4-5,8H,3,6,11H2,1-2H3,(H,12,16)(H,14,17) |
| InChIKey | RJEANHMIJOOOQF-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 102.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |