C10H17N5O4S — CID 43705849
2-amino-N-[1-(2-amino-2-oxoethyl)pyrazol-4-yl]-4-methylsulfonylbutanamide (PubChem CID 43705849) has the molecular formula C10H17N5O4S and a molecular weight of 303.34 g/mol. Its IUPAC name is 2-amino-N-[1-(2-amino-2-oxoethyl)pyrazol-4-yl]-4-methylsulfonylbutanamide.
| Compound Name | 2-amino-N-[1-(2-amino-2-oxoethyl)pyrazol-4-yl]-4-methylsulfonylbutanamide |
|---|---|
| PubChem CID | 43705849 |
| Molecular Formula | C10H17N5O4S |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | 2-amino-N-[1-(2-amino-2-oxoethyl)pyrazol-4-yl]-4-methylsulfonylbutanamide |
| SMILES | CS(=O)(=O)CCC(N)C(=O)Nc1cnn(CC(N)=O)c1 |
| InChI | InChI=1S/C10H17N5O4S/c1-20(18,19)3-2-8(11)10(17)14-7-4-13-15(5-7)6-9(12)16/h4-5,8H,2-3,6,11H2,1H3,(H2,12,16)(H,14,17) |
| InChIKey | RKEOMMQDGBIKLP-UHFFFAOYSA-N |
| XLogP | -1.93 |
| TPSA | 150.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | -1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |