C12H21N5O3 — CID 81082805
2-amino-5-methoxy-N-[1-[2-(methylamino)-2-oxoethyl]pyrazol-4-yl]pentanamide (PubChem CID 81082805) has the molecular formula C12H21N5O3 and a molecular weight of 283.33 g/mol. Its IUPAC name is 2-amino-5-methoxy-N-[1-[2-(methylamino)-2-oxoethyl]pyrazol-4-yl]pentanamide.
| Compound Name | 2-amino-5-methoxy-N-[1-[2-(methylamino)-2-oxoethyl]pyrazol-4-yl]pentanamide |
|---|---|
| PubChem CID | 81082805 |
| Molecular Formula | C12H21N5O3 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | 2-amino-5-methoxy-N-[1-[2-(methylamino)-2-oxoethyl]pyrazol-4-yl]pentanamide |
| SMILES | CNC(=O)Cn1cc(NC(=O)C(N)CCCOC)cn1 |
| InChI | InChI=1S/C12H21N5O3/c1-14-11(18)8-17-7-9(6-15-17)16-12(19)10(13)4-3-5-20-2/h6-7,10H,3-5,8,13H2,1-2H3,(H,14,18)(H,16,19) |
| InChIKey | DXLDIUOUFNCHNG-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 111.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|