C10H18N4OS — CID 60932429
N-methyl-2-[4-(3-methylsulfanylpropylamino)pyrazol-1-yl]acetamide (PubChem CID 60932429) has the molecular formula C10H18N4OS and a molecular weight of 242.35 g/mol. Its IUPAC name is N-methyl-2-[4-(3-methylsulfanylpropylamino)pyrazol-1-yl]acetamide.
| Compound Name | N-methyl-2-[4-(3-methylsulfanylpropylamino)pyrazol-1-yl]acetamide |
|---|---|
| PubChem CID | 60932429 |
| Molecular Formula | C10H18N4OS |
| Molecular Weight | 242.35 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | N-methyl-2-[4-(3-methylsulfanylpropylamino)pyrazol-1-yl]acetamide |
| SMILES | CNC(=O)Cn1cc(NCCCSC)cn1 |
| InChI | InChI=1S/C10H18N4OS/c1-11-10(15)8-14-7-9(6-13-14)12-4-3-5-16-2/h6-7,12H,3-5,8H2,1-2H3,(H,11,15) |
| InChIKey | SNRAXQVOQQVTTO-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.35 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|