C7H11N3O4S — CID 61018002
methyl 2-[4-(methanesulfonamido)pyrazol-1-yl]acetate (PubChem CID 61018002) has the molecular formula C7H11N3O4S and a molecular weight of 233.25 g/mol. Its IUPAC name is methyl 2-[4-(methanesulfonamido)pyrazol-1-yl]acetate.
| Compound Name | methyl 2-[4-(methanesulfonamido)pyrazol-1-yl]acetate |
|---|---|
| PubChem CID | 61018002 |
| Molecular Formula | C7H11N3O4S |
| Molecular Weight | 233.25 g/mol |
| Exact Mass | 233.05 |
| IUPAC Name | methyl 2-[4-(methanesulfonamido)pyrazol-1-yl]acetate |
| SMILES | COC(=O)Cn1cc(NS(C)(=O)=O)cn1 |
| InChI | InChI=1S/C7H11N3O4S/c1-14-7(11)5-10-4-6(3-8-10)9-15(2,12)13/h3-4,9H,5H2,1-2H3 |
| InChIKey | KEIPHTLRLBOHFY-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.25 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |