C8H13N3O5S — CID 55009982
2-[4-(2-methoxyethylsulfonylamino)pyrazol-1-yl]acetic acid (PubChem CID 55009982) has the molecular formula C8H13N3O5S and a molecular weight of 263.27 g/mol. Its IUPAC name is 2-[4-(2-methoxyethylsulfonylamino)pyrazol-1-yl]acetic acid.
| Compound Name | 2-[4-(2-methoxyethylsulfonylamino)pyrazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 55009982 |
| Molecular Formula | C8H13N3O5S |
| Molecular Weight | 263.27 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | 2-[4-(2-methoxyethylsulfonylamino)pyrazol-1-yl]acetic acid |
| SMILES | COCCS(=O)(=O)Nc1cnn(CC(=O)O)c1 |
| InChI | InChI=1S/C8H13N3O5S/c1-16-2-3-17(14,15)10-7-4-9-11(5-7)6-8(12)13/h4-5,10H,2-3,6H2,1H3,(H,12,13) |
| InChIKey | LGRPKSGERXSRHC-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.27 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |