C7H12ClN3O3S — CID 63664953
1-chloro-N-[1-(2-methoxyethyl)pyrazol-4-yl]methanesulfonamide (PubChem CID 63664953) has the molecular formula C7H12ClN3O3S and a molecular weight of 253.71 g/mol. Its IUPAC name is 1-chloro-N-[1-(2-methoxyethyl)pyrazol-4-yl]methanesulfonamide.
| Compound Name | 1-chloro-N-[1-(2-methoxyethyl)pyrazol-4-yl]methanesulfonamide |
|---|---|
| PubChem CID | 63664953 |
| Molecular Formula | C7H12ClN3O3S |
| Molecular Weight | 253.71 g/mol |
| Exact Mass | 253.03 |
| IUPAC Name | 1-chloro-N-[1-(2-methoxyethyl)pyrazol-4-yl]methanesulfonamide |
| SMILES | COCCn1cc(NS(=O)(=O)CCl)cn1 |
| InChI | InChI=1S/C7H12ClN3O3S/c1-14-3-2-11-5-7(4-9-11)10-15(12,13)6-8/h4-5,10H,2-3,6H2,1H3 |
| InChIKey | WVJCHIZIQHQAAA-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.71 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|