C9H14N4O5S — CID 60934478
3-[[1-[2-(methylamino)-2-oxoethyl]pyrazol-4-yl]sulfamoyl]propanoic acid (PubChem CID 60934478) has the molecular formula C9H14N4O5S and a molecular weight of 290.30 g/mol. Its IUPAC name is 3-[[1-[2-(methylamino)-2-oxoethyl]pyrazol-4-yl]sulfamoyl]propanoic acid.
| Compound Name | 3-[[1-[2-(methylamino)-2-oxoethyl]pyrazol-4-yl]sulfamoyl]propanoic acid |
|---|---|
| PubChem CID | 60934478 |
| Molecular Formula | C9H14N4O5S |
| Molecular Weight | 290.30 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 3-[[1-[2-(methylamino)-2-oxoethyl]pyrazol-4-yl]sulfamoyl]propanoic acid |
| SMILES | CNC(=O)Cn1cc(NS(=O)(=O)CCC(=O)O)cn1 |
| InChI | InChI=1S/C9H14N4O5S/c1-10-8(14)6-13-5-7(4-11-13)12-19(17,18)3-2-9(15)16/h4-5,12H,2-3,6H2,1H3,(H,10,14)(H,15,16) |
| InChIKey | OCOHFVZODASUGF-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 130.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.30 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |