C12H20N4O4S — CID 61017743
methyl 2-[4-[(3-methylpiperidin-1-yl)sulfonylamino]pyrazol-1-yl]acetate (PubChem CID 61017743) has the molecular formula C12H20N4O4S and a molecular weight of 316.38 g/mol. Its IUPAC name is methyl 2-[4-[(3-methylpiperidin-1-yl)sulfonylamino]pyrazol-1-yl]acetate.
| Compound Name | methyl 2-[4-[(3-methylpiperidin-1-yl)sulfonylamino]pyrazol-1-yl]acetate |
|---|---|
| PubChem CID | 61017743 |
| Molecular Formula | C12H20N4O4S |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | methyl 2-[4-[(3-methylpiperidin-1-yl)sulfonylamino]pyrazol-1-yl]acetate |
| SMILES | COC(=O)Cn1cc(NS(=O)(=O)N2CCCC(C)C2)cn1 |
| InChI | InChI=1S/C12H20N4O4S/c1-10-4-3-5-16(7-10)21(18,19)14-11-6-13-15(8-11)9-12(17)20-2/h6,8,10,14H,3-5,7,9H2,1-2H3 |
| InChIKey | IHFBAHUDFCMGPR-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |