C11H18N4O4S — CID 61017871
methyl 2-[4-(piperidin-1-ylsulfonylamino)pyrazol-1-yl]acetate (PubChem CID 61017871) has the molecular formula C11H18N4O4S and a molecular weight of 302.36 g/mol. Its IUPAC name is methyl 2-[4-(piperidin-1-ylsulfonylamino)pyrazol-1-yl]acetate.
| Compound Name | methyl 2-[4-(piperidin-1-ylsulfonylamino)pyrazol-1-yl]acetate |
|---|---|
| PubChem CID | 61017871 |
| Molecular Formula | C11H18N4O4S |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | methyl 2-[4-(piperidin-1-ylsulfonylamino)pyrazol-1-yl]acetate |
| SMILES | COC(=O)Cn1cc(NS(=O)(=O)N2CCCCC2)cn1 |
| InChI | InChI=1S/C11H18N4O4S/c1-19-11(16)9-14-8-10(7-12-14)13-20(17,18)15-5-3-2-4-6-15/h7-8,13H,2-6,9H2,1H3 |
| InChIKey | IFIPOOVJQXDTRZ-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |