C12H19N3O4S2 — CID 43624502
methyl 2-[2-(azepan-1-ylsulfonylamino)-1,3-thiazol-4-yl]acetate (PubChem CID 43624502) has the molecular formula C12H19N3O4S2 and a molecular weight of 333.44 g/mol. Its IUPAC name is methyl 2-[2-(azepan-1-ylsulfonylamino)-1,3-thiazol-4-yl]acetate.
| Compound Name | methyl 2-[2-(azepan-1-ylsulfonylamino)-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 43624502 |
| Molecular Formula | C12H19N3O4S2 |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | methyl 2-[2-(azepan-1-ylsulfonylamino)-1,3-thiazol-4-yl]acetate |
| SMILES | COC(=O)Cc1csc(NS(=O)(=O)N2CCCCCC2)n1 |
| InChI | InChI=1S/C12H19N3O4S2/c1-19-11(16)8-10-9-20-12(13-10)14-21(17,18)15-6-4-2-3-5-7-15/h9H,2-8H2,1H3,(H,13,14) |
| InChIKey | NZKIBDRUMMMDQP-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |