C10H18N4O2S2 — CID 64558487
N-[4-(1-aminoethyl)-1,3-thiazol-2-yl]piperidine-1-sulfonamide (PubChem CID 64558487) has the molecular formula C10H18N4O2S2 and a molecular weight of 290.41 g/mol. Its IUPAC name is N-[4-(1-aminoethyl)-1,3-thiazol-2-yl]piperidine-1-sulfonamide.
| Compound Name | N-[4-(1-aminoethyl)-1,3-thiazol-2-yl]piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 64558487 |
| Molecular Formula | C10H18N4O2S2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | N-[4-(1-aminoethyl)-1,3-thiazol-2-yl]piperidine-1-sulfonamide |
| SMILES | CC(N)c1csc(NS(=O)(=O)N2CCCCC2)n1 |
| InChI | InChI=1S/C10H18N4O2S2/c1-8(11)9-7-17-10(12-9)13-18(15,16)14-5-3-2-4-6-14/h7-8H,2-6,11H2,1H3,(H,12,13) |
| InChIKey | WEVITBSSLYVKPG-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |