C6H10N4OS — CID 64557109
[4-(1-aminoethyl)-1,3-thiazol-2-yl]urea (PubChem CID 64557109) has the molecular formula C6H10N4OS and a molecular weight of 186.24 g/mol. Its IUPAC name is [4-(1-aminoethyl)-1,3-thiazol-2-yl]urea.
| Compound Name | [4-(1-aminoethyl)-1,3-thiazol-2-yl]urea |
|---|---|
| PubChem CID | 64557109 |
| Molecular Formula | C6H10N4OS |
| Molecular Weight | 186.24 g/mol |
| Exact Mass | 186.06 |
| IUPAC Name | [4-(1-aminoethyl)-1,3-thiazol-2-yl]urea |
| SMILES | CC(N)c1csc(NC(N)=O)n1 |
| InChI | InChI=1S/C6H10N4OS/c1-3(7)4-2-12-6(9-4)10-5(8)11/h2-3H,7H2,1H3,(H3,8,9,10,11) |
| InChIKey | HVLYTCNLSCEXCS-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.24 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |