C12H13N3O3S — CID 114343473
N-[4-(1-aminoethyl)-1,3-thiazol-2-yl]-2,3-dihydroxybenzamide (PubChem CID 114343473) has the molecular formula C12H13N3O3S and a molecular weight of 279.32 g/mol. Its IUPAC name is N-[4-(1-aminoethyl)-1,3-thiazol-2-yl]-2,3-dihydroxybenzamide.
| Compound Name | N-[4-(1-aminoethyl)-1,3-thiazol-2-yl]-2,3-dihydroxybenzamide |
|---|---|
| PubChem CID | 114343473 |
| Molecular Formula | C12H13N3O3S |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | N-[4-(1-aminoethyl)-1,3-thiazol-2-yl]-2,3-dihydroxybenzamide |
| SMILES | CC(N)c1csc(NC(=O)c2cccc(O)c2O)n1 |
| InChI | InChI=1S/C12H13N3O3S/c1-6(13)8-5-19-12(14-8)15-11(18)7-3-2-4-9(16)10(7)17/h2-6,16-17H,13H2,1H3,(H,14,15,18) |
| InChIKey | ALMFXKQTBJXDRZ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|