C13H14FN3O2S — CID 65432061
N-[4-(1-aminoethyl)-1,3-thiazol-2-yl]-2-fluoro-6-methoxybenzamide (PubChem CID 65432061) has the molecular formula C13H14FN3O2S and a molecular weight of 295.34 g/mol. Its IUPAC name is N-[4-(1-aminoethyl)-1,3-thiazol-2-yl]-2-fluoro-6-methoxybenzamide.
| Compound Name | N-[4-(1-aminoethyl)-1,3-thiazol-2-yl]-2-fluoro-6-methoxybenzamide |
|---|---|
| PubChem CID | 65432061 |
| Molecular Formula | C13H14FN3O2S |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | N-[4-(1-aminoethyl)-1,3-thiazol-2-yl]-2-fluoro-6-methoxybenzamide |
| SMILES | COc1cccc(F)c1C(=O)Nc1nc(C(C)N)cs1 |
| InChI | InChI=1S/C13H14FN3O2S/c1-7(15)9-6-20-13(16-9)17-12(18)11-8(14)4-3-5-10(11)19-2/h3-7H,15H2,1-2H3,(H,16,17,18) |
| InChIKey | HJSKVIKYNDNMJU-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |