C11H20N4O2S2 — CID 64556904
N-[4-(1-aminoethyl)-1,3-thiazol-2-yl]azepane-1-sulfonamide (PubChem CID 64556904) has the molecular formula C11H20N4O2S2 and a molecular weight of 304.44 g/mol. Its IUPAC name is N-[4-(1-aminoethyl)-1,3-thiazol-2-yl]azepane-1-sulfonamide.
| Compound Name | N-[4-(1-aminoethyl)-1,3-thiazol-2-yl]azepane-1-sulfonamide |
|---|---|
| PubChem CID | 64556904 |
| Molecular Formula | C11H20N4O2S2 |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | N-[4-(1-aminoethyl)-1,3-thiazol-2-yl]azepane-1-sulfonamide |
| SMILES | CC(N)c1csc(NS(=O)(=O)N2CCCCCC2)n1 |
| InChI | InChI=1S/C11H20N4O2S2/c1-9(12)10-8-18-11(13-10)14-19(16,17)15-6-4-2-3-5-7-15/h8-9H,2-7,12H2,1H3,(H,13,14) |
| InChIKey | BMOFCHPIFAPXPJ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |