C12H15N3O4S2 — CID 61061458
methyl 2-[4-[(5-ethylthiophen-2-yl)sulfonylamino]pyrazol-1-yl]acetate (PubChem CID 61061458) has the molecular formula C12H15N3O4S2 and a molecular weight of 329.40 g/mol. Its IUPAC name is methyl 2-[4-[(5-ethylthiophen-2-yl)sulfonylamino]pyrazol-1-yl]acetate.
| Compound Name | methyl 2-[4-[(5-ethylthiophen-2-yl)sulfonylamino]pyrazol-1-yl]acetate |
|---|---|
| PubChem CID | 61061458 |
| Molecular Formula | C12H15N3O4S2 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.05 |
| IUPAC Name | methyl 2-[4-[(5-ethylthiophen-2-yl)sulfonylamino]pyrazol-1-yl]acetate |
| SMILES | CCc1ccc(S(=O)(=O)Nc2cnn(CC(=O)OC)c2)s1 |
| InChI | InChI=1S/C12H15N3O4S2/c1-3-10-4-5-12(20-10)21(17,18)14-9-6-13-15(7-9)8-11(16)19-2/h4-7,14H,3,8H2,1-2H3 |
| InChIKey | XHKMVQQARBQVGD-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |