C14H14N6O3S2 — CID 71792233
2-[4-[(5-ethylthiophen-2-yl)sulfonylamino]phenyl]tetrazole-5-carboxamide (PubChem CID 71792233) has the molecular formula C14H14N6O3S2 and a molecular weight of 378.44 g/mol. Its IUPAC name is 2-[4-[(5-ethylthiophen-2-yl)sulfonylamino]phenyl]tetrazole-5-carboxamide.
| Compound Name | 2-[4-[(5-ethylthiophen-2-yl)sulfonylamino]phenyl]tetrazole-5-carboxamide |
|---|---|
| PubChem CID | 71792233 |
| Molecular Formula | C14H14N6O3S2 |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.06 |
| IUPAC Name | 2-[4-[(5-ethylthiophen-2-yl)sulfonylamino]phenyl]tetrazole-5-carboxamide |
| SMILES | CCc1ccc(S(=O)(=O)Nc2ccc(-n3nnc(C(N)=O)n3)cc2)s1 |
| InChI | InChI=1S/C14H14N6O3S2/c1-2-11-7-8-12(24-11)25(22,23)18-9-3-5-10(6-4-9)20-17-14(13(15)21)16-19-20/h3-8,18H,2H2,1H3,(H2,15,21) |
| InChIKey | JFTOAQIWEQYTIL-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 132.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |