C14H12N6O5S2 — CID 71792239
methyl 3-[[4-(5-carbamoyltetrazol-2-yl)phenyl]sulfamoyl]thiophene-2-carboxylate (PubChem CID 71792239) has the molecular formula C14H12N6O5S2 and a molecular weight of 408.42 g/mol. Its IUPAC name is methyl 3-[[4-(5-carbamoyltetrazol-2-yl)phenyl]sulfamoyl]thiophene-2-carboxylate.
| Compound Name | methyl 3-[[4-(5-carbamoyltetrazol-2-yl)phenyl]sulfamoyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 71792239 |
| Molecular Formula | C14H12N6O5S2 |
| Molecular Weight | 408.42 g/mol |
| Exact Mass | 408.03 |
| IUPAC Name | methyl 3-[[4-(5-carbamoyltetrazol-2-yl)phenyl]sulfamoyl]thiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1S(=O)(=O)Nc1ccc(-n2nnc(C(N)=O)n2)cc1 |
| InChI | InChI=1S/C14H12N6O5S2/c1-25-14(22)11-10(6-7-26-11)27(23,24)18-8-2-4-9(5-3-8)20-17-13(12(15)21)16-19-20/h2-7,18H,1H3,(H2,15,21) |
| InChIKey | WQBFWLMUKDRWBA-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 159.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.42 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |