C9H9N3O4S2 — CID 61394313
methyl 3-(1H-pyrazol-5-ylsulfamoyl)thiophene-2-carboxylate (PubChem CID 61394313) has the molecular formula C9H9N3O4S2 and a molecular weight of 287.32 g/mol. Its IUPAC name is methyl 3-(1H-pyrazol-5-ylsulfamoyl)thiophene-2-carboxylate.
| Compound Name | methyl 3-(1H-pyrazol-5-ylsulfamoyl)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 61394313 |
| Molecular Formula | C9H9N3O4S2 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.00 |
| IUPAC Name | methyl 3-(1H-pyrazol-5-ylsulfamoyl)thiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1S(=O)(=O)Nc1ccn[nH]1 |
| InChI | InChI=1S/C9H9N3O4S2/c1-16-9(13)8-6(3-5-17-8)18(14,15)12-7-2-4-10-11-7/h2-5H,1H3,(H2,10,11,12) |
| InChIKey | WPFYMBFGFHHJNW-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |