C13H11N3O4S2 — CID 43047412
methyl 3-(1H-indazol-7-ylsulfamoyl)thiophene-2-carboxylate (PubChem CID 43047412) has the molecular formula C13H11N3O4S2 and a molecular weight of 337.38 g/mol. Its IUPAC name is methyl 3-(1H-indazol-7-ylsulfamoyl)thiophene-2-carboxylate.
| Compound Name | methyl 3-(1H-indazol-7-ylsulfamoyl)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 43047412 |
| Molecular Formula | C13H11N3O4S2 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.02 |
| IUPAC Name | methyl 3-(1H-indazol-7-ylsulfamoyl)thiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1S(=O)(=O)Nc1cccc2cn[nH]c12 |
| InChI | InChI=1S/C13H11N3O4S2/c1-20-13(17)12-10(5-6-21-12)22(18,19)16-9-4-2-3-8-7-14-15-11(8)9/h2-7,16H,1H3,(H,14,15) |
| InChIKey | HUDRYKZUQCMDAA-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |