About 3-methyl-N-(3-methyl-[1,2]oxazolo[5,4-b]pyridin-5-yl)piperidine-1-sulfonamide
3-methyl-N-(3-methyl-[1,2]oxazolo[5,4-b]pyridin-5-yl)piperidine-1-sulfonamide (PubChem CID 75533812) has the molecular formula C13H18N4O3S
and a molecular weight of 310.38 g/mol. Its IUPAC name is 3-methyl-N-(3-methyl-[1,2]oxazolo[5,4-b]pyridin-5-yl)piperidine-1-sulfonamide.
Molecular Properties
| Compound Name | 3-methyl-N-(3-methyl-[1,2]oxazolo[5,4-b]pyridin-5-yl)piperidine-1-sulfonamide |
| PubChem CID | 75533812 |
| Molecular Formula | C13H18N4O3S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 3-methyl-N-(3-methyl-[1,2]oxazolo[5,4-b]pyridin-5-yl)piperidine-1-sulfonamide |
| SMILES | Cc1noc2ncc(NS(=O)(=O)N3CCCC(C)C3)cc12 |
| InChI | InChI=1S/C13H18N4O3S/c1-9-4-3-5-17(8-9)21(18,19)16-11-6-12-10(2)15-20-13(12)14-7-11/h6-7,9,16H,3-5,8H2,1-2H3 |
| InChIKey | BAANRPMXSNPDSD-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-methyl-N-(3-methyl-[1,2]oxazolo[5,4-b]pyridin-5-yl)piperidine-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-N-(3-methyl-[1,2]oxazolo[5,4-b]pyridin-5-yl)piperidine-1-sulfonamide?
The IUPAC name of 3-methyl-N-(3-methyl-[1,2]oxazolo[5,4-b]pyridin-5-yl)piperidine-1-sulfonamide (CID 75533812) is 3-methyl-N-(3-methyl-[1,2]oxazolo[5,4-b]pyridin-5-yl)piperidine-1-sulfonamide.
What is the SMILES notation for 3-methyl-N-(3-methyl-[1,2]oxazolo[5,4-b]pyridin-5-yl)piperidine-1-sulfonamide?
The canonical SMILES for 3-methyl-N-(3-methyl-[1,2]oxazolo[5,4-b]pyridin-5-yl)piperidine-1-sulfonamide is Cc1noc2ncc(NS(=O)(=O)N3CCCC(C)C3)cc12.
What is the InChIKey of 3-methyl-N-(3-methyl-[1,2]oxazolo[5,4-b]pyridin-5-yl)piperidine-1-sulfonamide?
The InChIKey is BAANRPMXSNPDSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N4O3S/c1-9-4-3-5-17(8-9)21(18,19)16-11-6-12-10(2)15-20-13(12)14-7-11/h6-7,9,16H,3-5,8H2,1-2H3.
What are the key properties of 3-methyl-N-(3-methyl-[1,2]oxazolo[5,4-b]pyridin-5-yl)piperidine-1-sulfonamide?
3-methyl-N-(3-methyl-[1,2]oxazolo[5,4-b]pyridin-5-yl)piperidine-1-sulfonamide has a molecular weight of 310.38 g/mol, XLogP of 1.92, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-N-(3-methyl-[1,2]oxazolo[5,4-b]pyridin-5-yl)piperidine-1-sulfonamide is sourced from PubChem (CID 75533812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).