C14H20N2O3S — CID 62799710
N-(2-amino-5-propylsulfanylphenyl)-1,4-dioxane-2-carboxamide (PubChem CID 62799710) has the molecular formula C14H20N2O3S and a molecular weight of 296.39 g/mol. Its IUPAC name is N-(2-amino-5-propylsulfanylphenyl)-1,4-dioxane-2-carboxamide.
| Compound Name | N-(2-amino-5-propylsulfanylphenyl)-1,4-dioxane-2-carboxamide |
|---|---|
| PubChem CID | 62799710 |
| Molecular Formula | C14H20N2O3S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | N-(2-amino-5-propylsulfanylphenyl)-1,4-dioxane-2-carboxamide |
| SMILES | CCCSc1ccc(N)c(NC(=O)C2COCCO2)c1 |
| InChI | InChI=1S/C14H20N2O3S/c1-2-7-20-10-3-4-11(15)12(8-10)16-14(17)13-9-18-5-6-19-13/h3-4,8,13H,2,5-7,9,15H2,1H3,(H,16,17) |
| InChIKey | JYSVNJYQOYZFIL-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|