C20H25N3O4 — CID 119618898
N-(6-amino-1,3-benzodioxol-5-yl)-4-[2-(diethylamino)ethoxy]benzamide (PubChem CID 119618898) has the molecular formula C20H25N3O4 and a molecular weight of 371.44 g/mol. Its IUPAC name is N-(6-amino-1,3-benzodioxol-5-yl)-4-[2-(diethylamino)ethoxy]benzamide.
| Compound Name | N-(6-amino-1,3-benzodioxol-5-yl)-4-[2-(diethylamino)ethoxy]benzamide |
|---|---|
| PubChem CID | 119618898 |
| Molecular Formula | C20H25N3O4 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | N-(6-amino-1,3-benzodioxol-5-yl)-4-[2-(diethylamino)ethoxy]benzamide |
| SMILES | CCN(CC)CCOc1ccc(C(=O)Nc2cc3c(cc2N)OCO3)cc1 |
| InChI | InChI=1S/C20H25N3O4/c1-3-23(4-2)9-10-25-15-7-5-14(6-8-15)20(24)22-17-12-19-18(11-16(17)21)26-13-27-19/h5-8,11-12H,3-4,9-10,13,21H2,1-2H3,(H,22,24) |
| InChIKey | NGRQAYJEWRRZAB-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 86.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|