C18H26Cl2N4O2 — CID 119516313
N-(6-amino-3-pyridinyl)-4-[2-(diethylamino)ethoxy]benzamide;dihydrochloride (PubChem CID 119516313) has the molecular formula C18H26Cl2N4O2 and a molecular weight of 401.34 g/mol. Its IUPAC name is N-(6-amino-3-pyridinyl)-4-[2-(diethylamino)ethoxy]benzamide;dihydrochloride.
| Compound Name | N-(6-amino-3-pyridinyl)-4-[2-(diethylamino)ethoxy]benzamide;dihydrochloride |
|---|---|
| PubChem CID | 119516313 |
| Molecular Formula | C18H26Cl2N4O2 |
| Molecular Weight | 401.34 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | N-(6-amino-3-pyridinyl)-4-[2-(diethylamino)ethoxy]benzamide;dihydrochloride |
| SMILES | CCN(CC)CCOc1ccc(C(=O)Nc2ccc(N)nc2)cc1.Cl.Cl |
| InChI | InChI=1S/C18H24N4O2.2ClH/c1-3-22(4-2)11-12-24-16-8-5-14(6-9-16)18(23)21-15-7-10-17(19)20-13-15;;/h5-10,13H,3-4,11-12H2,1-2H3,(H2,19,20)(H,21,23);2*1H |
| InChIKey | GWEAVRBLEOSEPB-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.34 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |