C19H21NO2S2 — CID 86990667
4-(1,3-dithian-2-yl)-N-[2-(methoxymethyl)phenyl]benzamide (PubChem CID 86990667) has the molecular formula C19H21NO2S2 and a molecular weight of 359.52 g/mol. Its IUPAC name is 4-(1,3-dithian-2-yl)-N-[2-(methoxymethyl)phenyl]benzamide.
| Compound Name | 4-(1,3-dithian-2-yl)-N-[2-(methoxymethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 86990667 |
| Molecular Formula | C19H21NO2S2 |
| Molecular Weight | 359.52 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | 4-(1,3-dithian-2-yl)-N-[2-(methoxymethyl)phenyl]benzamide |
| SMILES | COCc1ccccc1NC(=O)c1ccc(C2SCCCS2)cc1 |
| InChI | InChI=1S/C19H21NO2S2/c1-22-13-16-5-2-3-6-17(16)20-18(21)14-7-9-15(10-8-14)19-23-11-4-12-24-19/h2-3,5-10,19H,4,11-13H2,1H3,(H,20,21) |
| InChIKey | WEFGSOVPOULRRH-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.52 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |