C15H17N3O2S — CID 51240513
N-(4,5-dihydro-1,3-thiazol-2-yl)-4-(2-oxopiperidin-1-yl)benzamide (PubChem CID 51240513) has the molecular formula C15H17N3O2S and a molecular weight of 303.39 g/mol. Its IUPAC name is N-(4,5-dihydro-1,3-thiazol-2-yl)-4-(2-oxopiperidin-1-yl)benzamide.
| Compound Name | N-(4,5-dihydro-1,3-thiazol-2-yl)-4-(2-oxopiperidin-1-yl)benzamide |
|---|---|
| PubChem CID | 51240513 |
| Molecular Formula | C15H17N3O2S |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | N-(4,5-dihydro-1,3-thiazol-2-yl)-4-(2-oxopiperidin-1-yl)benzamide |
| SMILES | O=C(NC1=NCCS1)c1ccc(N2CCCCC2=O)cc1 |
| InChI | InChI=1S/C15H17N3O2S/c19-13-3-1-2-9-18(13)12-6-4-11(5-7-12)14(20)17-15-16-8-10-21-15/h4-7H,1-3,8-10H2,(H,16,17,20) |
| InChIKey | QFLROUGWBDUYRL-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |