C8H9N3S — CID 5169811
N-pyridin-3-yl-4,5-dihydro-1,3-thiazol-2-amine (PubChem CID 5169811) has the molecular formula C8H9N3S and a molecular weight of 179.25 g/mol. Its IUPAC name is N-pyridin-3-yl-4,5-dihydro-1,3-thiazol-2-amine.
| Compound Name | N-pyridin-3-yl-4,5-dihydro-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 5169811 |
| Molecular Formula | C8H9N3S |
| Molecular Weight | 179.25 g/mol |
| Exact Mass | 179.05 |
| IUPAC Name | N-pyridin-3-yl-4,5-dihydro-1,3-thiazol-2-amine |
| SMILES | c1cncc(NC2=NCCS2)c1 |
| InChI | InChI=1S/C8H9N3S/c1-2-7(6-9-3-1)11-8-10-4-5-12-8/h1-3,6H,4-5H2,(H,10,11) |
| InChIKey | ULQUIWCIQNGLEN-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.25 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |