About N-pyridin-3-yl-4,5-dihydro-1,3-thiazol-2-amine
N-pyridin-3-yl-4,5-dihydro-1,3-thiazol-2-amine (PubChem CID 5169811) has the molecular formula C8H9N3S
and a molecular weight of 179.25 g/mol. Its IUPAC name is N-pyridin-3-yl-4,5-dihydro-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | N-pyridin-3-yl-4,5-dihydro-1,3-thiazol-2-amine |
| PubChem CID | 5169811 |
| Molecular Formula | C8H9N3S |
| Molecular Weight | 179.25 g/mol |
| Exact Mass | 179.05 |
| IUPAC Name | N-pyridin-3-yl-4,5-dihydro-1,3-thiazol-2-amine |
| SMILES | c1cncc(NC2=NCCS2)c1 |
| InChI | InChI=1S/C8H9N3S/c1-2-7(6-9-3-1)11-8-10-4-5-12-8/h1-3,6H,4-5H2,(H,10,11) |
| InChIKey | ULQUIWCIQNGLEN-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.25 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-pyridin-3-yl-4,5-dihydro-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-pyridin-3-yl-4,5-dihydro-1,3-thiazol-2-amine?
The IUPAC name of N-pyridin-3-yl-4,5-dihydro-1,3-thiazol-2-amine (CID 5169811) is N-pyridin-3-yl-4,5-dihydro-1,3-thiazol-2-amine.
What is the SMILES notation for N-pyridin-3-yl-4,5-dihydro-1,3-thiazol-2-amine?
The canonical SMILES for N-pyridin-3-yl-4,5-dihydro-1,3-thiazol-2-amine is c1cncc(NC2=NCCS2)c1.
What is the InChIKey of N-pyridin-3-yl-4,5-dihydro-1,3-thiazol-2-amine?
The InChIKey is ULQUIWCIQNGLEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3S/c1-2-7(6-9-3-1)11-8-10-4-5-12-8/h1-3,6H,4-5H2,(H,10,11).
What are the key properties of N-pyridin-3-yl-4,5-dihydro-1,3-thiazol-2-amine?
N-pyridin-3-yl-4,5-dihydro-1,3-thiazol-2-amine has a molecular weight of 179.25 g/mol, XLogP of 1.60, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-pyridin-3-yl-4,5-dihydro-1,3-thiazol-2-amine is sourced from PubChem (CID 5169811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).