C14H20N2OS — CID 62327728
N-(3-butan-2-yloxyphenyl)-5,6-dihydro-4H-1,3-thiazin-2-amine (PubChem CID 62327728) has the molecular formula C14H20N2OS and a molecular weight of 264.39 g/mol. Its IUPAC name is N-(3-butan-2-yloxyphenyl)-5,6-dihydro-4H-1,3-thiazin-2-amine.
| Compound Name | N-(3-butan-2-yloxyphenyl)-5,6-dihydro-4H-1,3-thiazin-2-amine |
|---|---|
| PubChem CID | 62327728 |
| Molecular Formula | C14H20N2OS |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | N-(3-butan-2-yloxyphenyl)-5,6-dihydro-4H-1,3-thiazin-2-amine |
| SMILES | CCC(C)Oc1cccc(NC2=NCCCS2)c1 |
| InChI | InChI=1S/C14H20N2OS/c1-3-11(2)17-13-7-4-6-12(10-13)16-14-15-8-5-9-18-14/h4,6-7,10-11H,3,5,8-9H2,1-2H3,(H,15,16) |
| InChIKey | LLLIKDLMYHBRFW-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |