C10H10ClN3 — CID 143391572
4-chloro-N-cyclohexa-1,5-dien-1-ylpyrimidin-2-amine (PubChem CID 143391572) has the molecular formula C10H10ClN3 and a molecular weight of 207.66 g/mol. Its IUPAC name is 4-chloro-N-cyclohexa-1,5-dien-1-ylpyrimidin-2-amine.
| Compound Name | 4-chloro-N-cyclohexa-1,5-dien-1-ylpyrimidin-2-amine |
|---|---|
| PubChem CID | 143391572 |
| Molecular Formula | C10H10ClN3 |
| Molecular Weight | 207.66 g/mol |
| Exact Mass | 207.06 |
| IUPAC Name | 4-chloro-N-cyclohexa-1,5-dien-1-ylpyrimidin-2-amine |
| SMILES | Clc1ccnc(NC2=CCCC=C2)n1 |
| InChI | InChI=1S/C10H10ClN3/c11-9-6-7-12-10(14-9)13-8-4-2-1-3-5-8/h2,4-7H,1,3H2,(H,12,13,14) |
| InChIKey | GFJANTSZVBHCJN-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.66 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |