C5H4ClN3O2 — CID 135282743
(4-chloropyrimidin-2-yl)carbamic acid (PubChem CID 135282743) has the molecular formula C5H4ClN3O2 and a molecular weight of 173.56 g/mol. Its IUPAC name is (4-chloropyrimidin-2-yl)carbamic acid.
| Compound Name | (4-chloropyrimidin-2-yl)carbamic acid |
|---|---|
| PubChem CID | 135282743 |
| Molecular Formula | C5H4ClN3O2 |
| Molecular Weight | 173.56 g/mol |
| Exact Mass | 173.00 |
| IUPAC Name | (4-chloropyrimidin-2-yl)carbamic acid |
| SMILES | O=C(O)Nc1nccc(Cl)n1 |
| InChI | InChI=1S/C5H4ClN3O2/c6-3-1-2-7-4(8-3)9-5(10)11/h1-2H,(H,10,11)(H,7,8,9) |
| InChIKey | AJCLYEFUAKBSCI-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.56 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |