C8H10ClN3 — CID 58495643
4-chloro-N-(cyclopropylmethyl)pyrimidin-2-amine (PubChem CID 58495643) has the molecular formula C8H10ClN3 and a molecular weight of 183.64 g/mol. Its IUPAC name is 4-chloro-N-(cyclopropylmethyl)pyrimidin-2-amine.
| Compound Name | 4-chloro-N-(cyclopropylmethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 58495643 |
| Molecular Formula | C8H10ClN3 |
| Molecular Weight | 183.64 g/mol |
| Exact Mass | 183.06 |
| IUPAC Name | 4-chloro-N-(cyclopropylmethyl)pyrimidin-2-amine |
| SMILES | Clc1ccnc(NCC2CC2)n1 |
| InChI | InChI=1S/C8H10ClN3/c9-7-3-4-10-8(12-7)11-5-6-1-2-6/h3-4,6H,1-2,5H2,(H,10,11,12) |
| InChIKey | OBQQERMGFCHIBM-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.64 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |