C12H14N2 — CID 156839435
3-N-cyclohexa-1,5-dien-1-ylbenzene-1,3-diamine (PubChem CID 156839435) has the molecular formula C12H14N2 and a molecular weight of 186.26 g/mol. Its IUPAC name is 3-N-cyclohexa-1,5-dien-1-ylbenzene-1,3-diamine.
| Compound Name | 3-N-cyclohexa-1,5-dien-1-ylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 156839435 |
| Molecular Formula | C12H14N2 |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 3-N-cyclohexa-1,5-dien-1-ylbenzene-1,3-diamine |
| SMILES | Nc1cccc(NC2=CCCC=C2)c1 |
| InChI | InChI=1S/C12H14N2/c13-10-5-4-8-12(9-10)14-11-6-2-1-3-7-11/h2,4-9,14H,1,3,13H2 |
| InChIKey | DXJDDHUVXNVFFK-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|