C8H10ClN3O4S2 — CID 114052602
N-(4-chloropyrimidin-2-yl)-1,1-dioxothiolane-3-sulfonamide (PubChem CID 114052602) has the molecular formula C8H10ClN3O4S2 and a molecular weight of 311.77 g/mol. Its IUPAC name is N-(4-chloropyrimidin-2-yl)-1,1-dioxothiolane-3-sulfonamide.
| Compound Name | N-(4-chloropyrimidin-2-yl)-1,1-dioxothiolane-3-sulfonamide |
|---|---|
| PubChem CID | 114052602 |
| Molecular Formula | C8H10ClN3O4S2 |
| Molecular Weight | 311.77 g/mol |
| Exact Mass | 310.98 |
| IUPAC Name | N-(4-chloropyrimidin-2-yl)-1,1-dioxothiolane-3-sulfonamide |
| SMILES | O=S1(=O)CCC(S(=O)(=O)Nc2nccc(Cl)n2)C1 |
| InChI | InChI=1S/C8H10ClN3O4S2/c9-7-1-3-10-8(11-7)12-18(15,16)6-2-4-17(13,14)5-6/h1,3,6H,2,4-5H2,(H,10,11,12) |
| InChIKey | QYWKHOVUGACQPT-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.77 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |