C9H11FN2O4S2 — CID 103777911
N-(6-fluoro-3-pyridinyl)-1,1-dioxothiolane-3-sulfonamide (PubChem CID 103777911) has the molecular formula C9H11FN2O4S2 and a molecular weight of 294.33 g/mol. Its IUPAC name is N-(6-fluoro-3-pyridinyl)-1,1-dioxothiolane-3-sulfonamide.
| Compound Name | N-(6-fluoro-3-pyridinyl)-1,1-dioxothiolane-3-sulfonamide |
|---|---|
| PubChem CID | 103777911 |
| Molecular Formula | C9H11FN2O4S2 |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.01 |
| IUPAC Name | N-(6-fluoro-3-pyridinyl)-1,1-dioxothiolane-3-sulfonamide |
| SMILES | O=S1(=O)CCC(S(=O)(=O)Nc2ccc(F)nc2)C1 |
| InChI | InChI=1S/C9H11FN2O4S2/c10-9-2-1-7(5-11-9)12-18(15,16)8-3-4-17(13,14)6-8/h1-2,5,8,12H,3-4,6H2 |
| InChIKey | SALPAXZFQGQMEL-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 93.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|