C12H16N2O4S3 — CID 62086198
4-[(1,1-dioxothian-4-yl)sulfonylamino]benzenecarbothioamide (PubChem CID 62086198) has the molecular formula C12H16N2O4S3 and a molecular weight of 348.47 g/mol. Its IUPAC name is 4-[(1,1-dioxothian-4-yl)sulfonylamino]benzenecarbothioamide.
| Compound Name | 4-[(1,1-dioxothian-4-yl)sulfonylamino]benzenecarbothioamide |
|---|---|
| PubChem CID | 62086198 |
| Molecular Formula | C12H16N2O4S3 |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.03 |
| IUPAC Name | 4-[(1,1-dioxothian-4-yl)sulfonylamino]benzenecarbothioamide |
| SMILES | NC(=S)c1ccc(NS(=O)(=O)C2CCS(=O)(=O)CC2)cc1 |
| InChI | InChI=1S/C12H16N2O4S3/c13-12(19)9-1-3-10(4-2-9)14-21(17,18)11-5-7-20(15,16)8-6-11/h1-4,11,14H,5-8H2,(H2,13,19) |
| InChIKey | OKRUYOQPMYZHAR-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|