C13H18N2O2S2 — CID 61066190
3-(cyclohexylsulfonylamino)benzenecarbothioamide (PubChem CID 61066190) has the molecular formula C13H18N2O2S2 and a molecular weight of 298.43 g/mol. Its IUPAC name is 3-(cyclohexylsulfonylamino)benzenecarbothioamide.
| Compound Name | 3-(cyclohexylsulfonylamino)benzenecarbothioamide |
|---|---|
| PubChem CID | 61066190 |
| Molecular Formula | C13H18N2O2S2 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 3-(cyclohexylsulfonylamino)benzenecarbothioamide |
| SMILES | NC(=S)c1cccc(NS(=O)(=O)C2CCCCC2)c1 |
| InChI | InChI=1S/C13H18N2O2S2/c14-13(18)10-5-4-6-11(9-10)15-19(16,17)12-7-2-1-3-8-12/h4-6,9,12,15H,1-3,7-8H2,(H2,14,18) |
| InChIKey | ZAQFNHSOKDMRLO-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|