C11H16N2O4S2 — CID 62086003
N-(3-aminophenyl)-1,1-dioxothiane-4-sulfonamide (PubChem CID 62086003) has the molecular formula C11H16N2O4S2 and a molecular weight of 304.39 g/mol. Its IUPAC name is N-(3-aminophenyl)-1,1-dioxothiane-4-sulfonamide.
| Compound Name | N-(3-aminophenyl)-1,1-dioxothiane-4-sulfonamide |
|---|---|
| PubChem CID | 62086003 |
| Molecular Formula | C11H16N2O4S2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | N-(3-aminophenyl)-1,1-dioxothiane-4-sulfonamide |
| SMILES | Nc1cccc(NS(=O)(=O)C2CCS(=O)(=O)CC2)c1 |
| InChI | InChI=1S/C11H16N2O4S2/c12-9-2-1-3-10(8-9)13-19(16,17)11-4-6-18(14,15)7-5-11/h1-3,8,11,13H,4-7,12H2 |
| InChIKey | ARPQKXZQZQVQKL-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|