C13H18N2O4S2 — CID 63931452
1,1-dioxo-N-(1,2,3,4-tetrahydroquinolin-7-yl)thiolane-3-sulfonamide (PubChem CID 63931452) has the molecular formula C13H18N2O4S2 and a molecular weight of 330.43 g/mol. Its IUPAC name is 1,1-dioxo-N-(1,2,3,4-tetrahydroquinolin-7-yl)thiolane-3-sulfonamide.
| Compound Name | 1,1-dioxo-N-(1,2,3,4-tetrahydroquinolin-7-yl)thiolane-3-sulfonamide |
|---|---|
| PubChem CID | 63931452 |
| Molecular Formula | C13H18N2O4S2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | 1,1-dioxo-N-(1,2,3,4-tetrahydroquinolin-7-yl)thiolane-3-sulfonamide |
| SMILES | O=S1(=O)CCC(S(=O)(=O)Nc2ccc3c(c2)NCCC3)C1 |
| InChI | InChI=1S/C13H18N2O4S2/c16-20(17)7-5-12(9-20)21(18,19)15-11-4-3-10-2-1-6-14-13(10)8-11/h3-4,8,12,14-15H,1-2,5-7,9H2 |
| InChIKey | JUSNPANBQGHAGR-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |