C9H10F2N2O4S2 — CID 103098191
N-(2,6-difluoro-3-pyridinyl)-1,1-dioxothiolane-3-sulfonamide (PubChem CID 103098191) has the molecular formula C9H10F2N2O4S2 and a molecular weight of 312.32 g/mol. Its IUPAC name is N-(2,6-difluoro-3-pyridinyl)-1,1-dioxothiolane-3-sulfonamide.
| Compound Name | N-(2,6-difluoro-3-pyridinyl)-1,1-dioxothiolane-3-sulfonamide |
|---|---|
| PubChem CID | 103098191 |
| Molecular Formula | C9H10F2N2O4S2 |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.01 |
| IUPAC Name | N-(2,6-difluoro-3-pyridinyl)-1,1-dioxothiolane-3-sulfonamide |
| SMILES | O=S1(=O)CCC(S(=O)(=O)Nc2ccc(F)nc2F)C1 |
| InChI | InChI=1S/C9H10F2N2O4S2/c10-8-2-1-7(9(11)12-8)13-19(16,17)6-3-4-18(14,15)5-6/h1-2,6,13H,3-5H2 |
| InChIKey | UFJGEHRFOLEVSP-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 93.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|