C11H13BrFNO4S2 — CID 62085486
N-(2-bromo-4-fluorophenyl)-1,1-dioxothiane-4-sulfonamide (PubChem CID 62085486) has the molecular formula C11H13BrFNO4S2 and a molecular weight of 386.26 g/mol. Its IUPAC name is N-(2-bromo-4-fluorophenyl)-1,1-dioxothiane-4-sulfonamide.
| Compound Name | N-(2-bromo-4-fluorophenyl)-1,1-dioxothiane-4-sulfonamide |
|---|---|
| PubChem CID | 62085486 |
| Molecular Formula | C11H13BrFNO4S2 |
| Molecular Weight | 386.26 g/mol |
| Exact Mass | 384.95 |
| IUPAC Name | N-(2-bromo-4-fluorophenyl)-1,1-dioxothiane-4-sulfonamide |
| SMILES | O=S1(=O)CCC(S(=O)(=O)Nc2ccc(F)cc2Br)CC1 |
| InChI | InChI=1S/C11H13BrFNO4S2/c12-10-7-8(13)1-2-11(10)14-20(17,18)9-3-5-19(15,16)6-4-9/h1-2,7,9,14H,3-6H2 |
| InChIKey | GYLDNQLYAYULHH-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.26 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |