C11H15BrN2O4S2 — CID 114447917
3-bromo-4-(cyclopentylsulfonylamino)benzenesulfonamide (PubChem CID 114447917) has the molecular formula C11H15BrN2O4S2 and a molecular weight of 383.29 g/mol. Its IUPAC name is 3-bromo-4-(cyclopentylsulfonylamino)benzenesulfonamide.
| Compound Name | 3-bromo-4-(cyclopentylsulfonylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 114447917 |
| Molecular Formula | C11H15BrN2O4S2 |
| Molecular Weight | 383.29 g/mol |
| Exact Mass | 381.97 |
| IUPAC Name | 3-bromo-4-(cyclopentylsulfonylamino)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(NS(=O)(=O)C2CCCC2)c(Br)c1 |
| InChI | InChI=1S/C11H15BrN2O4S2/c12-10-7-9(19(13,15)16)5-6-11(10)14-20(17,18)8-3-1-2-4-8/h5-8,14H,1-4H2,(H2,13,15,16) |
| InChIKey | TZKPLMQIGTYNNW-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.29 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |