C7H8F2N2O4S2 — CID 103098172
N-(2,6-difluoro-3-pyridinyl)-1-methylsulfonylmethanesulfonamide (PubChem CID 103098172) has the molecular formula C7H8F2N2O4S2 and a molecular weight of 286.28 g/mol. Its IUPAC name is N-(2,6-difluoro-3-pyridinyl)-1-methylsulfonylmethanesulfonamide.
| Compound Name | N-(2,6-difluoro-3-pyridinyl)-1-methylsulfonylmethanesulfonamide |
|---|---|
| PubChem CID | 103098172 |
| Molecular Formula | C7H8F2N2O4S2 |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 285.99 |
| IUPAC Name | N-(2,6-difluoro-3-pyridinyl)-1-methylsulfonylmethanesulfonamide |
| SMILES | CS(=O)(=O)CS(=O)(=O)Nc1ccc(F)nc1F |
| InChI | InChI=1S/C7H8F2N2O4S2/c1-16(12,13)4-17(14,15)11-5-2-3-6(8)10-7(5)9/h2-3,11H,4H2,1H3 |
| InChIKey | JZQSVYHDCKUREV-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 93.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|