C10H13F2N3O2S — CID 103098209
N-(2,6-difluoro-3-pyridinyl)piperidine-1-sulfonamide (PubChem CID 103098209) has the molecular formula C10H13F2N3O2S and a molecular weight of 277.30 g/mol. Its IUPAC name is N-(2,6-difluoro-3-pyridinyl)piperidine-1-sulfonamide.
| Compound Name | N-(2,6-difluoro-3-pyridinyl)piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 103098209 |
| Molecular Formula | C10H13F2N3O2S |
| Molecular Weight | 277.30 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | N-(2,6-difluoro-3-pyridinyl)piperidine-1-sulfonamide |
| SMILES | O=S(=O)(Nc1ccc(F)nc1F)N1CCCCC1 |
| InChI | InChI=1S/C10H13F2N3O2S/c11-9-5-4-8(10(12)13-9)14-18(16,17)15-6-2-1-3-7-15/h4-5,14H,1-3,6-7H2 |
| InChIKey | ZVIDFXOFTOUAHG-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.30 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|