C10H13F2N3O2S — CID 43550963
N-(5-amino-2,4-difluorophenyl)pyrrolidine-1-sulfonamide (PubChem CID 43550963) has the molecular formula C10H13F2N3O2S and a molecular weight of 277.30 g/mol. Its IUPAC name is N-(5-amino-2,4-difluorophenyl)pyrrolidine-1-sulfonamide.
| Compound Name | N-(5-amino-2,4-difluorophenyl)pyrrolidine-1-sulfonamide |
|---|---|
| PubChem CID | 43550963 |
| Molecular Formula | C10H13F2N3O2S |
| Molecular Weight | 277.30 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | N-(5-amino-2,4-difluorophenyl)pyrrolidine-1-sulfonamide |
| SMILES | Nc1cc(NS(=O)(=O)N2CCCC2)c(F)cc1F |
| InChI | InChI=1S/C10H13F2N3O2S/c11-7-5-8(12)10(6-9(7)13)14-18(16,17)15-3-1-2-4-15/h5-6,14H,1-4,13H2 |
| InChIKey | KFGURGUXJOSXFB-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.30 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|