C8H9FINO4S2 — CID 82843139
N-(4-fluoro-2-iodophenyl)-1-methylsulfonylmethanesulfonamide (PubChem CID 82843139) has the molecular formula C8H9FINO4S2 and a molecular weight of 393.20 g/mol. Its IUPAC name is N-(4-fluoro-2-iodophenyl)-1-methylsulfonylmethanesulfonamide.
| Compound Name | N-(4-fluoro-2-iodophenyl)-1-methylsulfonylmethanesulfonamide |
|---|---|
| PubChem CID | 82843139 |
| Molecular Formula | C8H9FINO4S2 |
| Molecular Weight | 393.20 g/mol |
| Exact Mass | 392.90 |
| IUPAC Name | N-(4-fluoro-2-iodophenyl)-1-methylsulfonylmethanesulfonamide |
| SMILES | CS(=O)(=O)CS(=O)(=O)Nc1ccc(F)cc1I |
| InChI | InChI=1S/C8H9FINO4S2/c1-16(12,13)5-17(14,15)11-8-3-2-6(9)4-7(8)10/h2-4,11H,5H2,1H3 |
| InChIKey | IUHMPFOQGIPUDS-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.20 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|