C10H12ClFINO2S — CID 79771397
3-chloro-N-(4-fluoro-2-iodophenyl)-2-methylpropane-1-sulfonamide (PubChem CID 79771397) has the molecular formula C10H12ClFINO2S and a molecular weight of 391.63 g/mol. Its IUPAC name is 3-chloro-N-(4-fluoro-2-iodophenyl)-2-methylpropane-1-sulfonamide.
| Compound Name | 3-chloro-N-(4-fluoro-2-iodophenyl)-2-methylpropane-1-sulfonamide |
|---|---|
| PubChem CID | 79771397 |
| Molecular Formula | C10H12ClFINO2S |
| Molecular Weight | 391.63 g/mol |
| Exact Mass | 390.93 |
| IUPAC Name | 3-chloro-N-(4-fluoro-2-iodophenyl)-2-methylpropane-1-sulfonamide |
| SMILES | CC(CCl)CS(=O)(=O)Nc1ccc(F)cc1I |
| InChI | InChI=1S/C10H12ClFINO2S/c1-7(5-11)6-17(15,16)14-10-3-2-8(12)4-9(10)13/h2-4,7,14H,5-6H2,1H3 |
| InChIKey | GGLYRMICOJVPBP-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.63 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|