C12H18ClNO3S — CID 79585941
3-chloro-N-(3-hydroxy-2,4-dimethylphenyl)-2-methylpropane-1-sulfonamide (PubChem CID 79585941) has the molecular formula C12H18ClNO3S and a molecular weight of 291.80 g/mol. Its IUPAC name is 3-chloro-N-(3-hydroxy-2,4-dimethylphenyl)-2-methylpropane-1-sulfonamide.
| Compound Name | 3-chloro-N-(3-hydroxy-2,4-dimethylphenyl)-2-methylpropane-1-sulfonamide |
|---|---|
| PubChem CID | 79585941 |
| Molecular Formula | C12H18ClNO3S |
| Molecular Weight | 291.80 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | 3-chloro-N-(3-hydroxy-2,4-dimethylphenyl)-2-methylpropane-1-sulfonamide |
| SMILES | Cc1ccc(NS(=O)(=O)CC(C)CCl)c(C)c1O |
| InChI | InChI=1S/C12H18ClNO3S/c1-8(6-13)7-18(16,17)14-11-5-4-9(2)12(15)10(11)3/h4-5,8,14-15H,6-7H2,1-3H3 |
| InChIKey | QYWRERRKPOKXMW-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.80 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|