C13H20ClNO4S — CID 79583591
3-chloro-N-(4,5-dimethoxy-2-methylphenyl)-2-methylpropane-1-sulfonamide (PubChem CID 79583591) has the molecular formula C13H20ClNO4S and a molecular weight of 321.83 g/mol. Its IUPAC name is 3-chloro-N-(4,5-dimethoxy-2-methylphenyl)-2-methylpropane-1-sulfonamide.
| Compound Name | 3-chloro-N-(4,5-dimethoxy-2-methylphenyl)-2-methylpropane-1-sulfonamide |
|---|---|
| PubChem CID | 79583591 |
| Molecular Formula | C13H20ClNO4S |
| Molecular Weight | 321.83 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 3-chloro-N-(4,5-dimethoxy-2-methylphenyl)-2-methylpropane-1-sulfonamide |
| SMILES | COc1cc(C)c(NS(=O)(=O)CC(C)CCl)cc1OC |
| InChI | InChI=1S/C13H20ClNO4S/c1-9(7-14)8-20(16,17)15-11-6-13(19-4)12(18-3)5-10(11)2/h5-6,9,15H,7-8H2,1-4H3 |
| InChIKey | CHNGUTQWXISKOX-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.83 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|