C9H13FN2O4S2 — CID 63245465
N-(2-amino-4-fluorophenyl)-2-methylsulfonylethanesulfonamide (PubChem CID 63245465) has the molecular formula C9H13FN2O4S2 and a molecular weight of 296.34 g/mol. Its IUPAC name is N-(2-amino-4-fluorophenyl)-2-methylsulfonylethanesulfonamide.
| Compound Name | N-(2-amino-4-fluorophenyl)-2-methylsulfonylethanesulfonamide |
|---|---|
| PubChem CID | 63245465 |
| Molecular Formula | C9H13FN2O4S2 |
| Molecular Weight | 296.34 g/mol |
| Exact Mass | 296.03 |
| IUPAC Name | N-(2-amino-4-fluorophenyl)-2-methylsulfonylethanesulfonamide |
| SMILES | CS(=O)(=O)CCS(=O)(=O)Nc1ccc(F)cc1N |
| InChI | InChI=1S/C9H13FN2O4S2/c1-17(13,14)4-5-18(15,16)12-9-3-2-7(10)6-8(9)11/h2-3,6,12H,4-5,11H2,1H3 |
| InChIKey | NULRDFKEJJMVPJ-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.34 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|